C9H16N2O4 — CID 166781014
(2R)-4-(formylcarbamoylamino)-2,4-dimethylpentanoic acid (PubChem CID 166781014) has the molecular formula C9H16N2O4 and a molecular weight of 216.24 g/mol. Its IUPAC name is (2R)-4-(formylcarbamoylamino)-2,4-dimethylpentanoic acid.
| Compound Name | (2R)-4-(formylcarbamoylamino)-2,4-dimethylpentanoic acid |
|---|---|
| PubChem CID | 166781014 |
| Molecular Formula | C9H16N2O4 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | (2R)-4-(formylcarbamoylamino)-2,4-dimethylpentanoic acid |
| SMILES | C[C@H](CC(C)(C)NC(=O)NC=O)C(=O)O |
| InChI | InChI=1S/C9H16N2O4/c1-6(7(13)14)4-9(2,3)11-8(15)10-5-12/h5-6H,4H2,1-3H3,(H,13,14)(H2,10,11,12,15)/t6-/m1/s1 |
| InChIKey | HXGQHENZCJPQMP-ZCFIWIBFSA-N |
| XLogP | 0.33 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|