C11H20O3 — CID 58489206
5-formyl-2,4,4-trimethylheptanoic acid (PubChem CID 58489206) has the molecular formula C11H20O3 and a molecular weight of 200.28 g/mol. Its IUPAC name is 5-formyl-2,4,4-trimethylheptanoic acid.
| Compound Name | 5-formyl-2,4,4-trimethylheptanoic acid |
|---|---|
| PubChem CID | 58489206 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | 5-formyl-2,4,4-trimethylheptanoic acid |
| SMILES | CCC(C=O)C(C)(C)CC(C)C(=O)O |
| InChI | InChI=1S/C11H20O3/c1-5-9(7-12)11(3,4)6-8(2)10(13)14/h7-9H,5-6H2,1-4H3,(H,13,14) |
| InChIKey | QKLWBWZFLKLVJT-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|