C13H28N2O — CID 58798763
1-tert-butyl-3-(2,4,4-trimethylpentan-2-yl)urea (PubChem CID 58798763) has the molecular formula C13H28N2O and a molecular weight of 228.38 g/mol. Its IUPAC name is 1-tert-butyl-3-(2,4,4-trimethylpentan-2-yl)urea.
| Compound Name | 1-tert-butyl-3-(2,4,4-trimethylpentan-2-yl)urea |
|---|---|
| PubChem CID | 58798763 |
| Molecular Formula | C13H28N2O |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.22 |
| IUPAC Name | 1-tert-butyl-3-(2,4,4-trimethylpentan-2-yl)urea |
| SMILES | CC(C)(C)CC(C)(C)NC(=O)NC(C)(C)C |
| InChI | InChI=1S/C13H28N2O/c1-11(2,3)9-13(7,8)15-10(16)14-12(4,5)6/h9H2,1-8H3,(H2,14,15,16) |
| InChIKey | ZSLHPLWVLCJANN-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |