C18H37N3O2 — CID 139447381
N-tert-butyl-5-(tert-butylcarbamoylamino)-2,2,5-trimethylhexanamide (PubChem CID 139447381) has the molecular formula C18H37N3O2 and a molecular weight of 327.51 g/mol. Its IUPAC name is N-tert-butyl-5-(tert-butylcarbamoylamino)-2,2,5-trimethylhexanamide.
| Compound Name | N-tert-butyl-5-(tert-butylcarbamoylamino)-2,2,5-trimethylhexanamide |
|---|---|
| PubChem CID | 139447381 |
| Molecular Formula | C18H37N3O2 |
| Molecular Weight | 327.51 g/mol |
| Exact Mass | 327.29 |
| IUPAC Name | N-tert-butyl-5-(tert-butylcarbamoylamino)-2,2,5-trimethylhexanamide |
| SMILES | CC(C)(C)NC(=O)NC(C)(C)CCC(C)(C)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C18H37N3O2/c1-15(2,3)19-13(22)17(7,8)11-12-18(9,10)21-14(23)20-16(4,5)6/h11-12H2,1-10H3,(H,19,22)(H2,20,21,23) |
| InChIKey | HUOVENREZOFGEL-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.51 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |