C17H33NO3 — CID 116537949
ethyl 3,3-dimethyl-2-(2,4,4-trimethylpentan-2-ylcarbamoyl)butanoate (PubChem CID 116537949) has the molecular formula C17H33NO3 and a molecular weight of 299.46 g/mol. Its IUPAC name is ethyl 3,3-dimethyl-2-(2,4,4-trimethylpentan-2-ylcarbamoyl)butanoate.
| Compound Name | ethyl 3,3-dimethyl-2-(2,4,4-trimethylpentan-2-ylcarbamoyl)butanoate |
|---|---|
| PubChem CID | 116537949 |
| Molecular Formula | C17H33NO3 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.25 |
| IUPAC Name | ethyl 3,3-dimethyl-2-(2,4,4-trimethylpentan-2-ylcarbamoyl)butanoate |
| SMILES | CCOC(=O)C(C(=O)NC(C)(C)CC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C17H33NO3/c1-10-21-14(20)12(16(5,6)7)13(19)18-17(8,9)11-15(2,3)4/h12H,10-11H2,1-9H3,(H,18,19) |
| InChIKey | KHGMZZIBWQILPM-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|