C14H25NO3 — CID 116538310
ethyl 3,3-dimethyl-2-[(1-methylcyclobutyl)carbamoyl]butanoate (PubChem CID 116538310) has the molecular formula C14H25NO3 and a molecular weight of 255.36 g/mol. Its IUPAC name is ethyl 3,3-dimethyl-2-[(1-methylcyclobutyl)carbamoyl]butanoate.
| Compound Name | ethyl 3,3-dimethyl-2-[(1-methylcyclobutyl)carbamoyl]butanoate |
|---|---|
| PubChem CID | 116538310 |
| Molecular Formula | C14H25NO3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | ethyl 3,3-dimethyl-2-[(1-methylcyclobutyl)carbamoyl]butanoate |
| SMILES | CCOC(=O)C(C(=O)NC1(C)CCC1)C(C)(C)C |
| InChI | InChI=1S/C14H25NO3/c1-6-18-12(17)10(13(2,3)4)11(16)15-14(5)8-7-9-14/h10H,6-9H2,1-5H3,(H,15,16) |
| InChIKey | BLXCXKLBOLLVFP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|