C15H27NO4 — CID 104918410
ethyl 2-[(1-methoxycyclobutyl)methylcarbamoyl]-3,3-dimethylbutanoate (PubChem CID 104918410) has the molecular formula C15H27NO4 and a molecular weight of 285.38 g/mol. Its IUPAC name is ethyl 2-[(1-methoxycyclobutyl)methylcarbamoyl]-3,3-dimethylbutanoate.
| Compound Name | ethyl 2-[(1-methoxycyclobutyl)methylcarbamoyl]-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 104918410 |
| Molecular Formula | C15H27NO4 |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | ethyl 2-[(1-methoxycyclobutyl)methylcarbamoyl]-3,3-dimethylbutanoate |
| SMILES | CCOC(=O)C(C(=O)NCC1(OC)CCC1)C(C)(C)C |
| InChI | InChI=1S/C15H27NO4/c1-6-20-13(18)11(14(2,3)4)12(17)16-10-15(19-5)8-7-9-15/h11H,6-10H2,1-5H3,(H,16,17) |
| InChIKey | FYBFAHSHJVZHRQ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|