C13H23NO5 — CID 116537472
2-[(3-methoxyoxolan-3-yl)methylcarbamoyl]-3,3-dimethylbutanoic acid (PubChem CID 116537472) has the molecular formula C13H23NO5 and a molecular weight of 273.33 g/mol. Its IUPAC name is 2-[(3-methoxyoxolan-3-yl)methylcarbamoyl]-3,3-dimethylbutanoic acid.
| Compound Name | 2-[(3-methoxyoxolan-3-yl)methylcarbamoyl]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 116537472 |
| Molecular Formula | C13H23NO5 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | 2-[(3-methoxyoxolan-3-yl)methylcarbamoyl]-3,3-dimethylbutanoic acid |
| SMILES | COC1(CNC(=O)C(C(=O)O)C(C)(C)C)CCOC1 |
| InChI | InChI=1S/C13H23NO5/c1-12(2,3)9(11(16)17)10(15)14-7-13(18-4)5-6-19-8-13/h9H,5-8H2,1-4H3,(H,14,15)(H,16,17) |
| InChIKey | GNEFCTDTSTYIHF-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|