C11H21NO3 — CID 104709004
N-[(3-methoxyoxolan-3-yl)methyl]-2,2-dimethylpropanamide (PubChem CID 104709004) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is N-[(3-methoxyoxolan-3-yl)methyl]-2,2-dimethylpropanamide.
| Compound Name | N-[(3-methoxyoxolan-3-yl)methyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 104709004 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | N-[(3-methoxyoxolan-3-yl)methyl]-2,2-dimethylpropanamide |
| SMILES | COC1(CNC(=O)C(C)(C)C)CCOC1 |
| InChI | InChI=1S/C11H21NO3/c1-10(2,3)9(13)12-7-11(14-4)5-6-15-8-11/h5-8H2,1-4H3,(H,12,13) |
| InChIKey | TVKLRFNQUMWEFT-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |