C10H15N3O4 — CID 113450295
N-(cyanomethyl)-N'-[(3-methoxyoxolan-3-yl)methyl]oxamide (PubChem CID 113450295) has the molecular formula C10H15N3O4 and a molecular weight of 241.25 g/mol. Its IUPAC name is N-(cyanomethyl)-N'-[(3-methoxyoxolan-3-yl)methyl]oxamide.
| Compound Name | N-(cyanomethyl)-N'-[(3-methoxyoxolan-3-yl)methyl]oxamide |
|---|---|
| PubChem CID | 113450295 |
| Molecular Formula | C10H15N3O4 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | N-(cyanomethyl)-N'-[(3-methoxyoxolan-3-yl)methyl]oxamide |
| SMILES | COC1(CNC(=O)C(=O)NCC#N)CCOC1 |
| InChI | InChI=1S/C10H15N3O4/c1-16-10(2-5-17-7-10)6-13-9(15)8(14)12-4-3-11/h2,4-7H2,1H3,(H,12,14)(H,13,15) |
| InChIKey | GOLXQTLSKADVRN-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|