C10H19NO4 — CID 116657841
propan-2-yl N-[(3-methoxyoxolan-3-yl)methyl]carbamate (PubChem CID 116657841) has the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. Its IUPAC name is propan-2-yl N-[(3-methoxyoxolan-3-yl)methyl]carbamate.
| Compound Name | propan-2-yl N-[(3-methoxyoxolan-3-yl)methyl]carbamate |
|---|---|
| PubChem CID | 116657841 |
| Molecular Formula | C10H19NO4 |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | propan-2-yl N-[(3-methoxyoxolan-3-yl)methyl]carbamate |
| SMILES | COC1(CNC(=O)OC(C)C)CCOC1 |
| InChI | InChI=1S/C10H19NO4/c1-8(2)15-9(12)11-6-10(13-3)4-5-14-7-10/h8H,4-7H2,1-3H3,(H,11,12) |
| InChIKey | XIRQPMCBPMHEEE-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |