C10H17ClN2O4 — CID 104764442
2-chloro-N-[(3-methoxyoxolan-3-yl)methylcarbamoyl]propanamide (PubChem CID 104764442) has the molecular formula C10H17ClN2O4 and a molecular weight of 264.71 g/mol. Its IUPAC name is 2-chloro-N-[(3-methoxyoxolan-3-yl)methylcarbamoyl]propanamide.
| Compound Name | 2-chloro-N-[(3-methoxyoxolan-3-yl)methylcarbamoyl]propanamide |
|---|---|
| PubChem CID | 104764442 |
| Molecular Formula | C10H17ClN2O4 |
| Molecular Weight | 264.71 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 2-chloro-N-[(3-methoxyoxolan-3-yl)methylcarbamoyl]propanamide |
| SMILES | COC1(CNC(=O)NC(=O)C(C)Cl)CCOC1 |
| InChI | InChI=1S/C10H17ClN2O4/c1-7(11)8(14)13-9(15)12-5-10(16-2)3-4-17-6-10/h7H,3-6H2,1-2H3,(H2,12,13,14,15) |
| InChIKey | SVGNIVKBDRWBNX-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.71 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|