C9H15ClN2O4 — CID 104764443
2-chloro-N-[(3-methoxyoxolan-3-yl)methylcarbamoyl]acetamide (PubChem CID 104764443) has the molecular formula C9H15ClN2O4 and a molecular weight of 250.68 g/mol. Its IUPAC name is 2-chloro-N-[(3-methoxyoxolan-3-yl)methylcarbamoyl]acetamide.
| Compound Name | 2-chloro-N-[(3-methoxyoxolan-3-yl)methylcarbamoyl]acetamide |
|---|---|
| PubChem CID | 104764443 |
| Molecular Formula | C9H15ClN2O4 |
| Molecular Weight | 250.68 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | 2-chloro-N-[(3-methoxyoxolan-3-yl)methylcarbamoyl]acetamide |
| SMILES | COC1(CNC(=O)NC(=O)CCl)CCOC1 |
| InChI | InChI=1S/C9H15ClN2O4/c1-15-9(2-3-16-6-9)5-11-8(14)12-7(13)4-10/h2-6H2,1H3,(H2,11,12,13,14) |
| InChIKey | HECSYASTCZDBFS-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.68 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|