C15H27NO5 — CID 10870349
diethyl 2-[1-(tert-butylamino)-2-methyl-1-oxopropan-2-yl]propanedioate (PubChem CID 10870349) has the molecular formula C15H27NO5 and a molecular weight of 301.38 g/mol. Its IUPAC name is diethyl 2-[1-(tert-butylamino)-2-methyl-1-oxopropan-2-yl]propanedioate.
| Compound Name | diethyl 2-[1-(tert-butylamino)-2-methyl-1-oxopropan-2-yl]propanedioate |
|---|---|
| PubChem CID | 10870349 |
| Molecular Formula | C15H27NO5 |
| Molecular Weight | 301.38 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | diethyl 2-[1-(tert-butylamino)-2-methyl-1-oxopropan-2-yl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)C(C)(C)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C15H27NO5/c1-8-20-11(17)10(12(18)21-9-2)15(6,7)13(19)16-14(3,4)5/h10H,8-9H2,1-7H3,(H,16,19) |
| InChIKey | ZUQBCSNUQPRROU-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.38 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|