C15H29NO5 — CID 129050698
acetamide;diethyl 2-(2,3-dimethylbutan-2-yl)propanedioate (PubChem CID 129050698) has the molecular formula C15H29NO5 and a molecular weight of 303.40 g/mol. Its IUPAC name is acetamide;diethyl 2-(2,3-dimethylbutan-2-yl)propanedioate.
| Compound Name | acetamide;diethyl 2-(2,3-dimethylbutan-2-yl)propanedioate |
|---|---|
| PubChem CID | 129050698 |
| Molecular Formula | C15H29NO5 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.20 |
| IUPAC Name | acetamide;diethyl 2-(2,3-dimethylbutan-2-yl)propanedioate |
| SMILES | CC(N)=O.CCOC(=O)C(C(=O)OCC)C(C)(C)C(C)C |
| InChI | InChI=1S/C13H24O4.C2H5NO/c1-7-16-11(14)10(12(15)17-8-2)13(5,6)9(3)4;1-2(3)4/h9-10H,7-8H2,1-6H3;1H3,(H2,3,4) |
| InChIKey | MBFUKDQEVUUUIC-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|