About 1-O-ethyl 3-O-(2-methylprop-2-enyl) 2-tert-butylpropanedioate
1-O-ethyl 3-O-(2-methylprop-2-enyl) 2-tert-butylpropanedioate (PubChem CID 54268855) has the molecular formula C13H22O4
and a molecular weight of 242.31 g/mol. Its IUPAC name is 1-O-ethyl 3-O-(2-methylprop-2-enyl) 2-tert-butylpropanedioate.
Molecular Properties
| Compound Name | 1-O-ethyl 3-O-(2-methylprop-2-enyl) 2-tert-butylpropanedioate |
| PubChem CID | 54268855 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 1-O-ethyl 3-O-(2-methylprop-2-enyl) 2-tert-butylpropanedioate |
| SMILES | C=C(C)COC(=O)C(C(=O)OCC)C(C)(C)C |
| InChI | InChI=1S/C13H22O4/c1-7-16-11(14)10(13(4,5)6)12(15)17-8-9(2)3/h10H,2,7-8H2,1,3-6H3 |
| InChIKey | RISLOLJZNZDHHU-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-O-ethyl 3-O-(2-methylprop-2-enyl) 2-tert-butylpropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-ethyl 3-O-(2-methylprop-2-enyl) 2-tert-butylpropanedioate?
The IUPAC name of 1-O-ethyl 3-O-(2-methylprop-2-enyl) 2-tert-butylpropanedioate (CID 54268855) is 1-O-ethyl 3-O-(2-methylprop-2-enyl) 2-tert-butylpropanedioate.
What is the SMILES notation for 1-O-ethyl 3-O-(2-methylprop-2-enyl) 2-tert-butylpropanedioate?
The canonical SMILES for 1-O-ethyl 3-O-(2-methylprop-2-enyl) 2-tert-butylpropanedioate is C=C(C)COC(=O)C(C(=O)OCC)C(C)(C)C.
What is the InChIKey of 1-O-ethyl 3-O-(2-methylprop-2-enyl) 2-tert-butylpropanedioate?
The InChIKey is RISLOLJZNZDHHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O4/c1-7-16-11(14)10(13(4,5)6)12(15)17-8-9(2)3/h10H,2,7-8H2,1,3-6H3.
What are the key properties of 1-O-ethyl 3-O-(2-methylprop-2-enyl) 2-tert-butylpropanedioate?
1-O-ethyl 3-O-(2-methylprop-2-enyl) 2-tert-butylpropanedioate has a molecular weight of 242.31 g/mol, XLogP of 2.33, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-ethyl 3-O-(2-methylprop-2-enyl) 2-tert-butylpropanedioate is sourced from PubChem (CID 54268855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).