C16H29NO3 — CID 116537712
ethyl 2-(azocane-1-carbonyl)-3,3-dimethylbutanoate (PubChem CID 116537712) has the molecular formula C16H29NO3 and a molecular weight of 283.41 g/mol. Its IUPAC name is ethyl 2-(azocane-1-carbonyl)-3,3-dimethylbutanoate.
| Compound Name | ethyl 2-(azocane-1-carbonyl)-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 116537712 |
| Molecular Formula | C16H29NO3 |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | ethyl 2-(azocane-1-carbonyl)-3,3-dimethylbutanoate |
| SMILES | CCOC(=O)C(C(=O)N1CCCCCCC1)C(C)(C)C |
| InChI | InChI=1S/C16H29NO3/c1-5-20-15(19)13(16(2,3)4)14(18)17-11-9-7-6-8-10-12-17/h13H,5-12H2,1-4H3 |
| InChIKey | OUNQBUJQYPMEIV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|