C14H26N2O3 — CID 116537814
ethyl 2-(1,4-diazepane-1-carbonyl)-3,3-dimethylbutanoate (PubChem CID 116537814) has the molecular formula C14H26N2O3 and a molecular weight of 270.37 g/mol. Its IUPAC name is ethyl 2-(1,4-diazepane-1-carbonyl)-3,3-dimethylbutanoate.
| Compound Name | ethyl 2-(1,4-diazepane-1-carbonyl)-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 116537814 |
| Molecular Formula | C14H26N2O3 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | ethyl 2-(1,4-diazepane-1-carbonyl)-3,3-dimethylbutanoate |
| SMILES | CCOC(=O)C(C(=O)N1CCCNCC1)C(C)(C)C |
| InChI | InChI=1S/C14H26N2O3/c1-5-19-13(18)11(14(2,3)4)12(17)16-9-6-7-15-8-10-16/h11,15H,5-10H2,1-4H3 |
| InChIKey | MZWGVRQTUWSAAF-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|