C16H29NO4 — CID 116537808
ethyl 2-(4-ethoxypiperidine-1-carbonyl)-3,3-dimethylbutanoate (PubChem CID 116537808) has the molecular formula C16H29NO4 and a molecular weight of 299.41 g/mol. Its IUPAC name is ethyl 2-(4-ethoxypiperidine-1-carbonyl)-3,3-dimethylbutanoate.
| Compound Name | ethyl 2-(4-ethoxypiperidine-1-carbonyl)-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 116537808 |
| Molecular Formula | C16H29NO4 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.21 |
| IUPAC Name | ethyl 2-(4-ethoxypiperidine-1-carbonyl)-3,3-dimethylbutanoate |
| SMILES | CCOC(=O)C(C(=O)N1CCC(OCC)CC1)C(C)(C)C |
| InChI | InChI=1S/C16H29NO4/c1-6-20-12-8-10-17(11-9-12)14(18)13(16(3,4)5)15(19)21-7-2/h12-13H,6-11H2,1-5H3 |
| InChIKey | UGFJIFXKEQNSLR-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|