C15H30N2O3 — CID 61164340
(2S)-2-amino-1-[4-(2-ethoxyethoxy)piperidin-1-yl]-3,3-dimethylbutan-1-one (PubChem CID 61164340) has the molecular formula C15H30N2O3 and a molecular weight of 286.42 g/mol. Its IUPAC name is (2S)-2-amino-1-[4-(2-ethoxyethoxy)piperidin-1-yl]-3,3-dimethylbutan-1-one.
| Compound Name | (2S)-2-amino-1-[4-(2-ethoxyethoxy)piperidin-1-yl]-3,3-dimethylbutan-1-one |
|---|---|
| PubChem CID | 61164340 |
| Molecular Formula | C15H30N2O3 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | (2S)-2-amino-1-[4-(2-ethoxyethoxy)piperidin-1-yl]-3,3-dimethylbutan-1-one |
| SMILES | CCOCCOC1CCN(C(=O)[C@@H](N)C(C)(C)C)CC1 |
| InChI | InChI=1S/C15H30N2O3/c1-5-19-10-11-20-12-6-8-17(9-7-12)14(18)13(16)15(2,3)4/h12-13H,5-11,16H2,1-4H3/t13-/m1/s1 |
| InChIKey | QEJCFPDFMLGMDD-CYBMUJFWSA-N |
| XLogP | 1.40 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|