C15H28O6 — CID 21053418
ethyl 2-methyl-2-[3-(2-methylprop-2-enylperoxy)propylperoxymethyl]butanoate (PubChem CID 21053418) has the molecular formula C15H28O6 and a molecular weight of 304.38 g/mol. Its IUPAC name is ethyl 2-methyl-2-[3-(2-methylprop-2-enylperoxy)propylperoxymethyl]butanoate.
| Compound Name | ethyl 2-methyl-2-[3-(2-methylprop-2-enylperoxy)propylperoxymethyl]butanoate |
|---|---|
| PubChem CID | 21053418 |
| Molecular Formula | C15H28O6 |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | ethyl 2-methyl-2-[3-(2-methylprop-2-enylperoxy)propylperoxymethyl]butanoate |
| SMILES | C=C(C)COOCCCOOCC(C)(CC)C(=O)OCC |
| InChI | InChI=1S/C15H28O6/c1-6-15(5,14(16)17-7-2)12-21-19-10-8-9-18-20-11-13(3)4/h3,6-12H2,1-2,4-5H3 |
| InChIKey | HKYJRRHQHUSEEO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|