C20H38O5 — CID 166789503
[3-ethoxy-2-methyl-2-(3-methylpentan-3-yloxymethyl)-3-oxopropyl] 2-ethyl-2-methylbutanoate (PubChem CID 166789503) has the molecular formula C20H38O5 and a molecular weight of 358.52 g/mol. Its IUPAC name is [3-ethoxy-2-methyl-2-(3-methylpentan-3-yloxymethyl)-3-oxopropyl] 2-ethyl-2-methylbutanoate.
| Compound Name | [3-ethoxy-2-methyl-2-(3-methylpentan-3-yloxymethyl)-3-oxopropyl] 2-ethyl-2-methylbutanoate |
|---|---|
| PubChem CID | 166789503 |
| Molecular Formula | C20H38O5 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.27 |
| IUPAC Name | [3-ethoxy-2-methyl-2-(3-methylpentan-3-yloxymethyl)-3-oxopropyl] 2-ethyl-2-methylbutanoate |
| SMILES | CCOC(=O)C(C)(COC(=O)C(C)(CC)CC)COC(C)(CC)CC |
| InChI | InChI=1S/C20H38O5/c1-9-18(6,10-2)16(21)24-14-19(7,17(22)23-13-5)15-25-20(8,11-3)12-4/h9-15H2,1-8H3 |
| InChIKey | LOBCYWGCWIOKBP-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |