C8H15O4S- — CID 174696519
2-ethoxycarbonyl-2-methylbutane-1-sulfinate (PubChem CID 174696519) has the molecular formula C8H15O4S- and a molecular weight of 207.27 g/mol. Its IUPAC name is 2-ethoxycarbonyl-2-methylbutane-1-sulfinate.
| Compound Name | 2-ethoxycarbonyl-2-methylbutane-1-sulfinate |
|---|---|
| PubChem CID | 174696519 |
| Molecular Formula | C8H15O4S- |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | 2-ethoxycarbonyl-2-methylbutane-1-sulfinate |
| SMILES | CCOC(=O)C(C)(CC)CS(=O)[O-] |
| InChI | InChI=1S/C8H16O4S/c1-4-8(3,6-13(10)11)7(9)12-5-2/h4-6H2,1-3H3,(H,10,11)/p-1 |
| InChIKey | VWCCDJXMRUAEGS-UHFFFAOYSA-M |
| XLogP | 0.84 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|