C14H27NO3 — CID 116537733
ethyl 2-[ethyl(propan-2-yl)carbamoyl]-3,3-dimethylbutanoate (PubChem CID 116537733) has the molecular formula C14H27NO3 and a molecular weight of 257.37 g/mol. Its IUPAC name is ethyl 2-[ethyl(propan-2-yl)carbamoyl]-3,3-dimethylbutanoate.
| Compound Name | ethyl 2-[ethyl(propan-2-yl)carbamoyl]-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 116537733 |
| Molecular Formula | C14H27NO3 |
| Molecular Weight | 257.37 g/mol |
| Exact Mass | 257.20 |
| IUPAC Name | ethyl 2-[ethyl(propan-2-yl)carbamoyl]-3,3-dimethylbutanoate |
| SMILES | CCOC(=O)C(C(=O)N(CC)C(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H27NO3/c1-8-15(10(3)4)12(16)11(14(5,6)7)13(17)18-9-2/h10-11H,8-9H2,1-7H3 |
| InChIKey | KXBLJEPFDIURRL-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.37 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|