C17H31NO3 — CID 116537665
ethyl 2-[cyclohexyl(ethyl)carbamoyl]-3,3-dimethylbutanoate (PubChem CID 116537665) has the molecular formula C17H31NO3 and a molecular weight of 297.44 g/mol. Its IUPAC name is ethyl 2-[cyclohexyl(ethyl)carbamoyl]-3,3-dimethylbutanoate.
| Compound Name | ethyl 2-[cyclohexyl(ethyl)carbamoyl]-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 116537665 |
| Molecular Formula | C17H31NO3 |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.23 |
| IUPAC Name | ethyl 2-[cyclohexyl(ethyl)carbamoyl]-3,3-dimethylbutanoate |
| SMILES | CCOC(=O)C(C(=O)N(CC)C1CCCCC1)C(C)(C)C |
| InChI | InChI=1S/C17H31NO3/c1-6-18(13-11-9-8-10-12-13)15(19)14(17(3,4)5)16(20)21-7-2/h13-14H,6-12H2,1-5H3 |
| InChIKey | OGCGUARKGCPRHB-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|