C10H17F2NO — CID 103515263
N-cyclohexyl-N-ethyl-2,2-difluoroacetamide (PubChem CID 103515263) has the molecular formula C10H17F2NO and a molecular weight of 205.25 g/mol. Its IUPAC name is N-cyclohexyl-N-ethyl-2,2-difluoroacetamide.
| Compound Name | N-cyclohexyl-N-ethyl-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 103515263 |
| Molecular Formula | C10H17F2NO |
| Molecular Weight | 205.25 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | N-cyclohexyl-N-ethyl-2,2-difluoroacetamide |
| SMILES | CCN(C(=O)C(F)F)C1CCCCC1 |
| InChI | InChI=1S/C10H17F2NO/c1-2-13(10(14)9(11)12)8-6-4-3-5-7-8/h8-9H,2-7H2,1H3 |
| InChIKey | XARINGQZONKWRF-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.25 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |