C9H15F2NO2 — CID 103514023
N-cyclobutyl-2,2-difluoro-N-(3-hydroxypropyl)acetamide (PubChem CID 103514023) has the molecular formula C9H15F2NO2 and a molecular weight of 207.22 g/mol. Its IUPAC name is N-cyclobutyl-2,2-difluoro-N-(3-hydroxypropyl)acetamide.
| Compound Name | N-cyclobutyl-2,2-difluoro-N-(3-hydroxypropyl)acetamide |
|---|---|
| PubChem CID | 103514023 |
| Molecular Formula | C9H15F2NO2 |
| Molecular Weight | 207.22 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | N-cyclobutyl-2,2-difluoro-N-(3-hydroxypropyl)acetamide |
| SMILES | O=C(C(F)F)N(CCCO)C1CCC1 |
| InChI | InChI=1S/C9H15F2NO2/c10-8(11)9(14)12(5-2-6-13)7-3-1-4-7/h7-8,13H,1-6H2 |
| InChIKey | IBXCBMPLSNCLEK-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.22 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |