C14H25NO4 — CID 102866004
2-[cyclobutyl(3-hydroxypropyl)carbamoyl]-3,3-dimethylbutanoic acid (PubChem CID 102866004) has the molecular formula C14H25NO4 and a molecular weight of 271.36 g/mol. Its IUPAC name is 2-[cyclobutyl(3-hydroxypropyl)carbamoyl]-3,3-dimethylbutanoic acid.
| Compound Name | 2-[cyclobutyl(3-hydroxypropyl)carbamoyl]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 102866004 |
| Molecular Formula | C14H25NO4 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | 2-[cyclobutyl(3-hydroxypropyl)carbamoyl]-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(C)C(C(=O)O)C(=O)N(CCCO)C1CCC1 |
| InChI | InChI=1S/C14H25NO4/c1-14(2,3)11(13(18)19)12(17)15(8-5-9-16)10-6-4-7-10/h10-11,16H,4-9H2,1-3H3,(H,18,19) |
| InChIKey | JKPNDGITVCKNBG-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|