C14H30N2O — CID 54949020
N,N-diethyl-2-(2,4,4-trimethylpentan-2-ylamino)acetamide (PubChem CID 54949020) has the molecular formula C14H30N2O and a molecular weight of 242.41 g/mol. Its IUPAC name is N,N-diethyl-2-(2,4,4-trimethylpentan-2-ylamino)acetamide.
| Compound Name | N,N-diethyl-2-(2,4,4-trimethylpentan-2-ylamino)acetamide |
|---|---|
| PubChem CID | 54949020 |
| Molecular Formula | C14H30N2O |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.24 |
| IUPAC Name | N,N-diethyl-2-(2,4,4-trimethylpentan-2-ylamino)acetamide |
| SMILES | CCN(CC)C(=O)CNC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C14H30N2O/c1-8-16(9-2)12(17)10-15-14(6,7)11-13(3,4)5/h15H,8-11H2,1-7H3 |
| InChIKey | KTZSQXXQRADDBK-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |