C12H26N2O2 — CID 114942112
2-[(2-ethoxy-2-methylpropyl)amino]-N,N-diethylacetamide (PubChem CID 114942112) has the molecular formula C12H26N2O2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 2-[(2-ethoxy-2-methylpropyl)amino]-N,N-diethylacetamide.
| Compound Name | 2-[(2-ethoxy-2-methylpropyl)amino]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 114942112 |
| Molecular Formula | C12H26N2O2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | 2-[(2-ethoxy-2-methylpropyl)amino]-N,N-diethylacetamide |
| SMILES | CCOC(C)(C)CNCC(=O)N(CC)CC |
| InChI | InChI=1S/C12H26N2O2/c1-6-14(7-2)11(15)9-13-10-12(4,5)16-8-3/h13H,6-10H2,1-5H3 |
| InChIKey | QJZJVJCZYYNVKZ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |