About 3-[(2-ethoxy-2-methylpropyl)amino]-2,2-dimethylpropanoic acid
3-[(2-ethoxy-2-methylpropyl)amino]-2,2-dimethylpropanoic acid (PubChem CID 114941755) has the molecular formula C11H23NO3
and a molecular weight of 217.31 g/mol. Its IUPAC name is 3-[(2-ethoxy-2-methylpropyl)amino]-2,2-dimethylpropanoic acid.
Analyze 3-[(2-ethoxy-2-methylpropyl)amino]-2,2-dimethylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-ethoxy-2-methylpropyl)amino]-2,2-dimethylpropanoic acid?
The IUPAC name of 3-[(2-ethoxy-2-methylpropyl)amino]-2,2-dimethylpropanoic acid (CID 114941755) is 3-[(2-ethoxy-2-methylpropyl)amino]-2,2-dimethylpropanoic acid.
What is the SMILES notation for 3-[(2-ethoxy-2-methylpropyl)amino]-2,2-dimethylpropanoic acid?
The canonical SMILES for 3-[(2-ethoxy-2-methylpropyl)amino]-2,2-dimethylpropanoic acid is CCOC(C)(C)CNCC(C)(C)C(=O)O.
What is the InChIKey of 3-[(2-ethoxy-2-methylpropyl)amino]-2,2-dimethylpropanoic acid?
The InChIKey is QRZYOSFJRALVFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO3/c1-6-15-11(4,5)8-12-7-10(2,3)9(13)14/h12H,6-8H2,1-5H3,(H,13,14).
What are the key properties of 3-[(2-ethoxy-2-methylpropyl)amino]-2,2-dimethylpropanoic acid?
3-[(2-ethoxy-2-methylpropyl)amino]-2,2-dimethylpropanoic acid has a molecular weight of 217.31 g/mol, XLogP of 1.50, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-ethoxy-2-methylpropyl)amino]-2,2-dimethylpropanoic acid is sourced from PubChem (CID 114941755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).