2,2-dimethyl-3-(2,2,2-trifluoroethylamino)propanoic acid

C7H12F3NO2 — CID 79629822

IUPAC2,2-dimethyl-3-(2,2,2-trifluoroethylamino)propanoic acid
SMILESCC(C)(CNCC(F)(F)F)C(=O)O
InChIInChI=1S/C7H12F3NO2/c1-6(2,5(12)13)3-11-4-7(8,9)10/h11H,3-4H2,1-2H3,(H,12,13)
InChIKeyFGEQVEPZRXCRNV-UHFFFAOYSA-N
MW199.17 g/mol
LogP1.25
Rot. Bonds4

About 2,2-dimethyl-3-(2,2,2-trifluoroethylamino)propanoic acid

2,2-dimethyl-3-(2,2,2-trifluoroethylamino)propanoic acid (PubChem CID 79629822) has the molecular formula C7H12F3NO2 and a molecular weight of 199.17 g/mol. Its IUPAC name is 2,2-dimethyl-3-(2,2,2-trifluoroethylamino)propanoic acid.

Molecular Properties

Compound Name2,2-dimethyl-3-(2,2,2-trifluoroethylamino)propanoic acid
PubChem CID79629822
Molecular FormulaC7H12F3NO2
Molecular Weight199.17 g/mol
Exact Mass199.08
IUPAC Name2,2-dimethyl-3-(2,2,2-trifluoroethylamino)propanoic acid
SMILESCC(C)(CNCC(F)(F)F)C(=O)O
InChIInChI=1S/C7H12F3NO2/c1-6(2,5(12)13)3-11-4-7(8,9)10/h11H,3-4H2,1-2H3,(H,12,13)
InChIKeyFGEQVEPZRXCRNV-UHFFFAOYSA-N
XLogP1.25
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500199.17
LogP ≤ 51.25
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2,2-dimethyl-3-(2,2,2-trifluoroethylamino)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2-dimethyl-3-(2,2,2-trifluoroethylamino)propanoic acid?
The IUPAC name of 2,2-dimethyl-3-(2,2,2-trifluoroethylamino)propanoic acid (CID 79629822) is 2,2-dimethyl-3-(2,2,2-trifluoroethylamino)propanoic acid.
What is the SMILES notation for 2,2-dimethyl-3-(2,2,2-trifluoroethylamino)propanoic acid?
The canonical SMILES for 2,2-dimethyl-3-(2,2,2-trifluoroethylamino)propanoic acid is CC(C)(CNCC(F)(F)F)C(=O)O.
What is the InChIKey of 2,2-dimethyl-3-(2,2,2-trifluoroethylamino)propanoic acid?
The InChIKey is FGEQVEPZRXCRNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12F3NO2/c1-6(2,5(12)13)3-11-4-7(8,9)10/h11H,3-4H2,1-2H3,(H,12,13).
What are the key properties of 2,2-dimethyl-3-(2,2,2-trifluoroethylamino)propanoic acid?
2,2-dimethyl-3-(2,2,2-trifluoroethylamino)propanoic acid has a molecular weight of 199.17 g/mol, XLogP of 1.25, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-3-(2,2,2-trifluoroethylamino)propanoic acid is sourced from PubChem (CID 79629822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).