C15H30N2O2 — CID 108526227
N'-butyl-N'-methyl-N-(2,4,4-trimethylpentan-2-yl)oxamide (PubChem CID 108526227) has the molecular formula C15H30N2O2 and a molecular weight of 270.42 g/mol. Its IUPAC name is N'-butyl-N'-methyl-N-(2,4,4-trimethylpentan-2-yl)oxamide.
| Compound Name | N'-butyl-N'-methyl-N-(2,4,4-trimethylpentan-2-yl)oxamide |
|---|---|
| PubChem CID | 108526227 |
| Molecular Formula | C15H30N2O2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | N'-butyl-N'-methyl-N-(2,4,4-trimethylpentan-2-yl)oxamide |
| SMILES | CCCCN(C)C(=O)C(=O)NC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C15H30N2O2/c1-8-9-10-17(7)13(19)12(18)16-15(5,6)11-14(2,3)4/h8-11H2,1-7H3,(H,16,18) |
| InChIKey | KWRLJWZYIPPRIK-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|