C9H19N3O2 — CID 154666633
N'-[3-(dimethylamino)propyl]-N,N'-dimethyloxamide (PubChem CID 154666633) has the molecular formula C9H19N3O2 and a molecular weight of 201.27 g/mol. Its IUPAC name is N'-[3-(dimethylamino)propyl]-N,N'-dimethyloxamide.
| Compound Name | N'-[3-(dimethylamino)propyl]-N,N'-dimethyloxamide |
|---|---|
| PubChem CID | 154666633 |
| Molecular Formula | C9H19N3O2 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | N'-[3-(dimethylamino)propyl]-N,N'-dimethyloxamide |
| SMILES | CNC(=O)C(=O)N(C)CCCN(C)C |
| InChI | InChI=1S/C9H19N3O2/c1-10-8(13)9(14)12(4)7-5-6-11(2)3/h5-7H2,1-4H3,(H,10,13) |
| InChIKey | GOOPYNMUCXASPZ-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|