C17H34N4O3 — CID 20664951
N,N'-bis[3-(dimethylamino)propyl]-N,N'-dimethyl-3-oxopentanediamide (PubChem CID 20664951) has the molecular formula C17H34N4O3 and a molecular weight of 342.48 g/mol. Its IUPAC name is N,N'-bis[3-(dimethylamino)propyl]-N,N'-dimethyl-3-oxopentanediamide.
| Compound Name | N,N'-bis[3-(dimethylamino)propyl]-N,N'-dimethyl-3-oxopentanediamide |
|---|---|
| PubChem CID | 20664951 |
| Molecular Formula | C17H34N4O3 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | N,N'-bis[3-(dimethylamino)propyl]-N,N'-dimethyl-3-oxopentanediamide |
| SMILES | CN(C)CCCN(C)C(=O)CC(=O)CC(=O)N(C)CCCN(C)C |
| InChI | InChI=1S/C17H34N4O3/c1-18(2)9-7-11-20(5)16(23)13-15(22)14-17(24)21(6)12-8-10-19(3)4/h7-14H2,1-6H3 |
| InChIKey | JPGISVIWPLKJLD-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 64.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|