C8H15N3O4 — CID 108527985
N-(2-acetamidoethyl)-N'-(2-hydroxyethyl)oxamide (PubChem CID 108527985) has the molecular formula C8H15N3O4 and a molecular weight of 217.22 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-N'-(2-hydroxyethyl)oxamide.
| Compound Name | N-(2-acetamidoethyl)-N'-(2-hydroxyethyl)oxamide |
|---|---|
| PubChem CID | 108527985 |
| Molecular Formula | C8H15N3O4 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | N-(2-acetamidoethyl)-N'-(2-hydroxyethyl)oxamide |
| SMILES | CC(=O)NCCNC(=O)C(=O)NCCO |
| InChI | InChI=1S/C8H15N3O4/c1-6(13)9-2-3-10-7(14)8(15)11-4-5-12/h12H,2-5H2,1H3,(H,9,13)(H,10,14)(H,11,15) |
| InChIKey | QJSBFQREAULOOB-UHFFFAOYSA-N |
| XLogP | -2.65 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | -2.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|