About N-(2-acetamidoethyl)-N'-(2-hydroxyethyl)oxamide
N-(2-acetamidoethyl)-N'-(2-hydroxyethyl)oxamide (PubChem CID 108527985) has the molecular formula C8H15N3O4
and a molecular weight of 217.22 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-N'-(2-hydroxyethyl)oxamide.
Molecular Properties
| Compound Name | N-(2-acetamidoethyl)-N'-(2-hydroxyethyl)oxamide |
| PubChem CID | 108527985 |
| Molecular Formula | C8H15N3O4 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | N-(2-acetamidoethyl)-N'-(2-hydroxyethyl)oxamide |
| SMILES | CC(=O)NCCNC(=O)C(=O)NCCO |
| InChI | InChI=1S/C8H15N3O4/c1-6(13)9-2-3-10-7(14)8(15)11-4-5-12/h12H,2-5H2,1H3,(H,9,13)(H,10,14)(H,11,15) |
| InChIKey | QJSBFQREAULOOB-UHFFFAOYSA-N |
| XLogP | -2.65 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | -2.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(2-acetamidoethyl)-N'-(2-hydroxyethyl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-acetamidoethyl)-N'-(2-hydroxyethyl)oxamide?
The IUPAC name of N-(2-acetamidoethyl)-N'-(2-hydroxyethyl)oxamide (CID 108527985) is N-(2-acetamidoethyl)-N'-(2-hydroxyethyl)oxamide.
What is the SMILES notation for N-(2-acetamidoethyl)-N'-(2-hydroxyethyl)oxamide?
The canonical SMILES for N-(2-acetamidoethyl)-N'-(2-hydroxyethyl)oxamide is CC(=O)NCCNC(=O)C(=O)NCCO.
What is the InChIKey of N-(2-acetamidoethyl)-N'-(2-hydroxyethyl)oxamide?
The InChIKey is QJSBFQREAULOOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3O4/c1-6(13)9-2-3-10-7(14)8(15)11-4-5-12/h12H,2-5H2,1H3,(H,9,13)(H,10,14)(H,11,15).
What are the key properties of N-(2-acetamidoethyl)-N'-(2-hydroxyethyl)oxamide?
N-(2-acetamidoethyl)-N'-(2-hydroxyethyl)oxamide has a molecular weight of 217.22 g/mol, XLogP of -2.65, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-acetamidoethyl)-N'-(2-hydroxyethyl)oxamide is sourced from PubChem (CID 108527985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).