C10H19N3O5 — CID 108530037
N-(2-acetamidoethyl)-N'-(2,2-dimethoxyethyl)oxamide (PubChem CID 108530037) has the molecular formula C10H19N3O5 and a molecular weight of 261.28 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-N'-(2,2-dimethoxyethyl)oxamide.
| Compound Name | N-(2-acetamidoethyl)-N'-(2,2-dimethoxyethyl)oxamide |
|---|---|
| PubChem CID | 108530037 |
| Molecular Formula | C10H19N3O5 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | N-(2-acetamidoethyl)-N'-(2,2-dimethoxyethyl)oxamide |
| SMILES | COC(CNC(=O)C(=O)NCCNC(C)=O)OC |
| InChI | InChI=1S/C10H19N3O5/c1-7(14)11-4-5-12-9(15)10(16)13-6-8(17-2)18-3/h8H,4-6H2,1-3H3,(H,11,14)(H,12,15)(H,13,16) |
| InChIKey | WVINRUXMTYHPSI-UHFFFAOYSA-N |
| XLogP | -2.03 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|