C10H20N2O5 — CID 108526359
N-(2,2-dimethoxyethyl)-N'-(1-hydroxybutan-2-yl)oxamide (PubChem CID 108526359) has the molecular formula C10H20N2O5 and a molecular weight of 248.28 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-N'-(1-hydroxybutan-2-yl)oxamide.
| Compound Name | N-(2,2-dimethoxyethyl)-N'-(1-hydroxybutan-2-yl)oxamide |
|---|---|
| PubChem CID | 108526359 |
| Molecular Formula | C10H20N2O5 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-N'-(1-hydroxybutan-2-yl)oxamide |
| SMILES | CCC(CO)NC(=O)C(=O)NCC(OC)OC |
| InChI | InChI=1S/C10H20N2O5/c1-4-7(6-13)12-10(15)9(14)11-5-8(16-2)17-3/h7-8,13H,4-6H2,1-3H3,(H,11,14)(H,12,15) |
| InChIKey | XPFYQOCMTZPVLF-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|