C13H27N3O7 — CID 91212468
2,2-dimethoxyethanamine;N-(2,2-dimethoxyethyl)-N'-(2-oxopropyl)oxamide (PubChem CID 91212468) has the molecular formula C13H27N3O7 and a molecular weight of 337.37 g/mol. Its IUPAC name is 2,2-dimethoxyethanamine;N-(2,2-dimethoxyethyl)-N'-(2-oxopropyl)oxamide.
| Compound Name | 2,2-dimethoxyethanamine;N-(2,2-dimethoxyethyl)-N'-(2-oxopropyl)oxamide |
|---|---|
| PubChem CID | 91212468 |
| Molecular Formula | C13H27N3O7 |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 2,2-dimethoxyethanamine;N-(2,2-dimethoxyethyl)-N'-(2-oxopropyl)oxamide |
| SMILES | COC(CN)OC.COC(CNC(=O)C(=O)NCC(C)=O)OC |
| InChI | InChI=1S/C9H16N2O5.C4H11NO2/c1-6(12)4-10-8(13)9(14)11-5-7(15-2)16-3;1-6-4(3-5)7-2/h7H,4-5H2,1-3H3,(H,10,13)(H,11,14);4H,3,5H2,1-2H3 |
| InChIKey | HMHTWEDVSILJFL-UHFFFAOYSA-N |
| XLogP | -2.01 |
| TPSA | 138.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|