C10H18N2O4 — CID 166103905
N'-cyclobutyl-N-(2,2-dimethoxyethyl)oxamide (PubChem CID 166103905) has the molecular formula C10H18N2O4 and a molecular weight of 230.26 g/mol. Its IUPAC name is N'-cyclobutyl-N-(2,2-dimethoxyethyl)oxamide.
| Compound Name | N'-cyclobutyl-N-(2,2-dimethoxyethyl)oxamide |
|---|---|
| PubChem CID | 166103905 |
| Molecular Formula | C10H18N2O4 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | N'-cyclobutyl-N-(2,2-dimethoxyethyl)oxamide |
| SMILES | COC(CNC(=O)C(=O)NC1CCC1)OC |
| InChI | InChI=1S/C10H18N2O4/c1-15-8(16-2)6-11-9(13)10(14)12-7-4-3-5-7/h7-8H,3-6H2,1-2H3,(H,11,13)(H,12,14) |
| InChIKey | FZRJBGYVQRDBON-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|