C10H21N3O3 — CID 141131312
1-(2,2-dimethoxyethyl)-3-piperidin-4-ylurea (PubChem CID 141131312) has the molecular formula C10H21N3O3 and a molecular weight of 231.30 g/mol. Its IUPAC name is 1-(2,2-dimethoxyethyl)-3-piperidin-4-ylurea.
| Compound Name | 1-(2,2-dimethoxyethyl)-3-piperidin-4-ylurea |
|---|---|
| PubChem CID | 141131312 |
| Molecular Formula | C10H21N3O3 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 1-(2,2-dimethoxyethyl)-3-piperidin-4-ylurea |
| SMILES | COC(CNC(=O)NC1CCNCC1)OC |
| InChI | InChI=1S/C10H21N3O3/c1-15-9(16-2)7-12-10(14)13-8-3-5-11-6-4-8/h8-9,11H,3-7H2,1-2H3,(H2,12,13,14) |
| InChIKey | SKIIGGRWFMOBDN-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|