C8H18N4O — CID 174543793
1-(dimethylamino)-3-piperidin-4-ylurea (PubChem CID 174543793) has the molecular formula C8H18N4O and a molecular weight of 186.26 g/mol. Its IUPAC name is 1-(dimethylamino)-3-piperidin-4-ylurea.
| Compound Name | 1-(dimethylamino)-3-piperidin-4-ylurea |
|---|---|
| PubChem CID | 174543793 |
| Molecular Formula | C8H18N4O |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.15 |
| IUPAC Name | 1-(dimethylamino)-3-piperidin-4-ylurea |
| SMILES | CN(C)NC(=O)NC1CCNCC1 |
| InChI | InChI=1S/C8H18N4O/c1-12(2)11-8(13)10-7-3-5-9-6-4-7/h7,9H,3-6H2,1-2H3,(H2,10,11,13) |
| InChIKey | OCSGUDZJRIFVPQ-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|