C8H14N2O3 — CID 51471601
N'-cyclopropyl-N-[(2R)-2-hydroxypropyl]oxamide (PubChem CID 51471601) has the molecular formula C8H14N2O3 and a molecular weight of 186.21 g/mol. Its IUPAC name is N'-cyclopropyl-N-[(2R)-2-hydroxypropyl]oxamide.
| Compound Name | N'-cyclopropyl-N-[(2R)-2-hydroxypropyl]oxamide |
|---|---|
| PubChem CID | 51471601 |
| Molecular Formula | C8H14N2O3 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | N'-cyclopropyl-N-[(2R)-2-hydroxypropyl]oxamide |
| SMILES | C[C@@H](O)CNC(=O)C(=O)NC1CC1 |
| InChI | InChI=1S/C8H14N2O3/c1-5(11)4-9-7(12)8(13)10-6-2-3-6/h5-6,11H,2-4H2,1H3,(H,9,12)(H,10,13)/t5-/m1/s1 |
| InChIKey | RIWXDFCXAJEPGA-RXMQYKEDSA-N |
| XLogP | -1.24 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|