C12H22N2O3 — CID 95984687
N'-cyclopropyl-N-[(3S)-3-hydroxy-4,4-dimethylpentyl]oxamide (PubChem CID 95984687) has the molecular formula C12H22N2O3 and a molecular weight of 242.32 g/mol. Its IUPAC name is N'-cyclopropyl-N-[(3S)-3-hydroxy-4,4-dimethylpentyl]oxamide.
| Compound Name | N'-cyclopropyl-N-[(3S)-3-hydroxy-4,4-dimethylpentyl]oxamide |
|---|---|
| PubChem CID | 95984687 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | N'-cyclopropyl-N-[(3S)-3-hydroxy-4,4-dimethylpentyl]oxamide |
| SMILES | CC(C)(C)[C@@H](O)CCNC(=O)C(=O)NC1CC1 |
| InChI | InChI=1S/C12H22N2O3/c1-12(2,3)9(15)6-7-13-10(16)11(17)14-8-4-5-8/h8-9,15H,4-7H2,1-3H3,(H,13,16)(H,14,17)/t9-/m0/s1 |
| InChIKey | DQHACLNADOUOLY-VIFPVBQESA-N |
| XLogP | 0.18 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|