C9H17N3O2 — CID 3312354
N'-cyclopropyl-N-[2-(dimethylamino)ethyl]oxamide (PubChem CID 3312354) has the molecular formula C9H17N3O2 and a molecular weight of 199.25 g/mol. Its IUPAC name is N'-cyclopropyl-N-[2-(dimethylamino)ethyl]oxamide.
| Compound Name | N'-cyclopropyl-N-[2-(dimethylamino)ethyl]oxamide |
|---|---|
| PubChem CID | 3312354 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | N'-cyclopropyl-N-[2-(dimethylamino)ethyl]oxamide |
| SMILES | CN(C)CCNC(=O)C(=O)NC1CC1 |
| InChI | InChI=1S/C9H17N3O2/c1-12(2)6-5-10-8(13)9(14)11-7-3-4-7/h7H,3-6H2,1-2H3,(H,10,13)(H,11,14) |
| InChIKey | XHFKLOZCDYZNKQ-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|