C12H20N2O3 — CID 111425530
N-(2-cyclopentyl-2-hydroxyethyl)-N'-cyclopropyloxamide (PubChem CID 111425530) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is N-(2-cyclopentyl-2-hydroxyethyl)-N'-cyclopropyloxamide.
| Compound Name | N-(2-cyclopentyl-2-hydroxyethyl)-N'-cyclopropyloxamide |
|---|---|
| PubChem CID | 111425530 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | N-(2-cyclopentyl-2-hydroxyethyl)-N'-cyclopropyloxamide |
| SMILES | O=C(NCC(O)C1CCCC1)C(=O)NC1CC1 |
| InChI | InChI=1S/C12H20N2O3/c15-10(8-3-1-2-4-8)7-13-11(16)12(17)14-9-5-6-9/h8-10,15H,1-7H2,(H,13,16)(H,14,17) |
| InChIKey | NTTIKYHQSDHSBF-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|