C13H25NO2 — CID 95292122
N-[(2R)-2-cyclohexyl-2-hydroxyethyl]-2,2-dimethylpropanamide (PubChem CID 95292122) has the molecular formula C13H25NO2 and a molecular weight of 227.35 g/mol. Its IUPAC name is N-[(2R)-2-cyclohexyl-2-hydroxyethyl]-2,2-dimethylpropanamide.
| Compound Name | N-[(2R)-2-cyclohexyl-2-hydroxyethyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 95292122 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | N-[(2R)-2-cyclohexyl-2-hydroxyethyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)NC[C@H](O)C1CCCCC1 |
| InChI | InChI=1S/C13H25NO2/c1-13(2,3)12(16)14-9-11(15)10-7-5-4-6-8-10/h10-11,15H,4-9H2,1-3H3,(H,14,16)/t11-/m0/s1 |
| InChIKey | MEMFNBRMCHBAMW-NSHDSACASA-N |
| XLogP | 2.09 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |