C17H24FNO3 — CID 111426344
N-(2-cyclopentyl-2-hydroxyethyl)-2-(4-fluorophenoxy)-2-methylpropanamide (PubChem CID 111426344) has the molecular formula C17H24FNO3 and a molecular weight of 309.38 g/mol. Its IUPAC name is N-(2-cyclopentyl-2-hydroxyethyl)-2-(4-fluorophenoxy)-2-methylpropanamide.
| Compound Name | N-(2-cyclopentyl-2-hydroxyethyl)-2-(4-fluorophenoxy)-2-methylpropanamide |
|---|---|
| PubChem CID | 111426344 |
| Molecular Formula | C17H24FNO3 |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | N-(2-cyclopentyl-2-hydroxyethyl)-2-(4-fluorophenoxy)-2-methylpropanamide |
| SMILES | CC(C)(Oc1ccc(F)cc1)C(=O)NCC(O)C1CCCC1 |
| InChI | InChI=1S/C17H24FNO3/c1-17(2,22-14-9-7-13(18)8-10-14)16(21)19-11-15(20)12-5-3-4-6-12/h7-10,12,15,20H,3-6,11H2,1-2H3,(H,19,21) |
| InChIKey | UBMNZFXEFGKJPO-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |