About N-cyclobutyl-N'-propan-2-yloxamide
N-cyclobutyl-N'-propan-2-yloxamide (PubChem CID 130668799) has the molecular formula C9H16N2O2
and a molecular weight of 184.24 g/mol. Its IUPAC name is N-cyclobutyl-N'-propan-2-yloxamide.
Molecular Properties
| Compound Name | N-cyclobutyl-N'-propan-2-yloxamide |
| PubChem CID | 130668799 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | N-cyclobutyl-N'-propan-2-yloxamide |
| SMILES | CC(C)NC(=O)C(=O)NC1CCC1 |
| InChI | InChI=1S/C9H16N2O2/c1-6(2)10-8(12)9(13)11-7-4-3-5-7/h6-7H,3-5H2,1-2H3,(H,10,12)(H,11,13) |
| InChIKey | SBPRNGYNUMVMRK-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-cyclobutyl-N'-propan-2-yloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclobutyl-N'-propan-2-yloxamide?
The IUPAC name of N-cyclobutyl-N'-propan-2-yloxamide (CID 130668799) is N-cyclobutyl-N'-propan-2-yloxamide.
What is the SMILES notation for N-cyclobutyl-N'-propan-2-yloxamide?
The canonical SMILES for N-cyclobutyl-N'-propan-2-yloxamide is CC(C)NC(=O)C(=O)NC1CCC1.
What is the InChIKey of N-cyclobutyl-N'-propan-2-yloxamide?
The InChIKey is SBPRNGYNUMVMRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O2/c1-6(2)10-8(12)9(13)11-7-4-3-5-7/h6-7H,3-5H2,1-2H3,(H,10,12)(H,11,13).
What are the key properties of N-cyclobutyl-N'-propan-2-yloxamide?
N-cyclobutyl-N'-propan-2-yloxamide has a molecular weight of 184.24 g/mol, XLogP of 0.18, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclobutyl-N'-propan-2-yloxamide is sourced from PubChem (CID 130668799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).