C13H24N2O3 — CID 51894478
N-cycloheptyl-N'-[(2R)-1-methoxypropan-2-yl]oxamide (PubChem CID 51894478) has the molecular formula C13H24N2O3 and a molecular weight of 256.35 g/mol. Its IUPAC name is N-cycloheptyl-N'-[(2R)-1-methoxypropan-2-yl]oxamide.
| Compound Name | N-cycloheptyl-N'-[(2R)-1-methoxypropan-2-yl]oxamide |
|---|---|
| PubChem CID | 51894478 |
| Molecular Formula | C13H24N2O3 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | N-cycloheptyl-N'-[(2R)-1-methoxypropan-2-yl]oxamide |
| SMILES | COC[C@@H](C)NC(=O)C(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C13H24N2O3/c1-10(9-18-2)14-12(16)13(17)15-11-7-5-3-4-6-8-11/h10-11H,3-9H2,1-2H3,(H,14,16)(H,15,17)/t10-/m1/s1 |
| InChIKey | FTWUFDRYEZHJDE-SNVBAGLBSA-N |
| XLogP | 0.98 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|